C15H22BrClN2O — CID 63387700
1-[2-(3-bromophenoxy)ethyl]-4-(2-chloroethyl)-1,4-diazepane (PubChem CID 63387700) has the molecular formula C15H22BrClN2O and a molecular weight of 361.71 g/mol. Its IUPAC name is 1-[2-(3-bromophenoxy)ethyl]-4-(2-chloroethyl)-1,4-diazepane.
| Compound Name | 1-[2-(3-bromophenoxy)ethyl]-4-(2-chloroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 63387700 |
| Molecular Formula | C15H22BrClN2O |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1-[2-(3-bromophenoxy)ethyl]-4-(2-chloroethyl)-1,4-diazepane |
| SMILES | ClCCN1CCCN(CCOc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H22BrClN2O/c16-14-3-1-4-15(13-14)20-12-11-19-7-2-6-18(8-5-17)9-10-19/h1,3-4,13H,2,5-12H2 |
| InChIKey | ZMLOBEKTYDJIKK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|