C15H23ClN2O — CID 63387533
1-(2-chloroethyl)-4-(2-phenoxyethyl)-1,4-diazepane (PubChem CID 63387533) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(2-phenoxyethyl)-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-(2-phenoxyethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 63387533 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(2-chloroethyl)-4-(2-phenoxyethyl)-1,4-diazepane |
| SMILES | ClCCN1CCCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C15H23ClN2O/c16-7-10-17-8-4-9-18(12-11-17)13-14-19-15-5-2-1-3-6-15/h1-3,5-6H,4,7-14H2 |
| InChIKey | AVHGIHVXNGPFCT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|