C16H25BrN2O — CID 80668169
1-(2-bromoethyl)-4-(3-phenoxypropyl)-1,4-diazepane (PubChem CID 80668169) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-(3-phenoxypropyl)-1,4-diazepane.
| Compound Name | 1-(2-bromoethyl)-4-(3-phenoxypropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 80668169 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(2-bromoethyl)-4-(3-phenoxypropyl)-1,4-diazepane |
| SMILES | BrCCN1CCCN(CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C16H25BrN2O/c17-8-12-19-10-4-9-18(13-14-19)11-5-15-20-16-6-2-1-3-7-16/h1-3,6-7H,4-5,8-15H2 |
| InChIKey | KGICSVJCAKTSDW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|