C13H18BrNOS — CID 54971594
4-[2-(3-bromophenoxy)ethyl]-1,4-thiazepane (PubChem CID 54971594) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is 4-[2-(3-bromophenoxy)ethyl]-1,4-thiazepane.
| Compound Name | 4-[2-(3-bromophenoxy)ethyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 54971594 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-[2-(3-bromophenoxy)ethyl]-1,4-thiazepane |
| SMILES | Brc1cccc(OCCN2CCCSCC2)c1 |
| InChI | InChI=1S/C13H18BrNOS/c14-12-3-1-4-13(11-12)16-8-6-15-5-2-9-17-10-7-15/h1,3-4,11H,2,5-10H2 |
| InChIKey | UTFKKBGUWOWVKW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |