C15H20BrN3O2 — CID 115965447
5-bromo-6-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 115965447) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 5-bromo-6-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-6-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115965447 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 5-bromo-6-[3-(1-hydroxyethyl)pyrrolidin-1-yl]-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(N3CCC(C(C)O)C3)c(Br)cc21 |
| InChI | InChI=1S/C15H20BrN3O2/c1-8(20)9-3-4-19(7-9)13-6-12-10(5-11(13)16)14(17-2)15(21)18-12/h5-6,8-9,14,17,20H,3-4,7H2,1-2H3,(H,18,21) |
| InChIKey | AZFRDHKTFGEKTD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|