C16H19NO4 — CID 115966680
(E)-3-[3-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]phenyl]prop-2-enoic acid (PubChem CID 115966680) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (E)-3-[3-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115966680 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (E)-3-[3-[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]phenyl]prop-2-enoic acid |
| SMILES | CC(O)C1CCN(C(=O)c2cccc(/C=C/C(=O)O)c2)C1 |
| InChI | InChI=1S/C16H19NO4/c1-11(18)14-7-8-17(10-14)16(21)13-4-2-3-12(9-13)5-6-15(19)20/h2-6,9,11,14,18H,7-8,10H2,1H3,(H,19,20)/b6-5+ |
| InChIKey | UICUQXFSXMGCAH-AATRIKPKSA-N |
| XLogP | 1.63 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|