C14H15NO5S — CID 76906794
3-[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]prop-2-enoic acid (PubChem CID 76906794) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906794 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-[3-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(C(=O)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C14H15NO5S/c16-13(17)5-4-11-2-1-3-12(10-11)14(18)15-6-8-21(19,20)9-7-15/h1-5,10H,6-9H2,(H,16,17) |
| InChIKey | VHJFQZWVXSTPFJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|