C17H21NO3 — CID 77016560
3-[3-(3,3-dimethylpiperidine-1-carbonyl)phenyl]prop-2-enoic acid (PubChem CID 77016560) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[3-(3,3-dimethylpiperidine-1-carbonyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(3,3-dimethylpiperidine-1-carbonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77016560 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[3-(3,3-dimethylpiperidine-1-carbonyl)phenyl]prop-2-enoic acid |
| SMILES | CC1(C)CCCN(C(=O)c2cccc(C=CC(=O)O)c2)C1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2)9-4-10-18(12-17)16(21)14-6-3-5-13(11-14)7-8-15(19)20/h3,5-8,11H,4,9-10,12H2,1-2H3,(H,19,20) |
| InChIKey | ZSEAXGRBJYAARX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|