C16H19NO4 — CID 76906957
3-[3-(3,3-dimethylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid (PubChem CID 76906957) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[3-(3,3-dimethylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(3,3-dimethylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906957 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-[3-(3,3-dimethylmorpholine-4-carbonyl)phenyl]prop-2-enoic acid |
| SMILES | CC1(C)COCCN1C(=O)c1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)11-21-9-8-17(16)15(20)13-5-3-4-12(10-13)6-7-14(18)19/h3-7,10H,8-9,11H2,1-2H3,(H,18,19) |
| InChIKey | ZWNLKUHIZZWHHE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|