C22H21N3O4S — CID 11597005
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-dione (PubChem CID 11597005) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 11597005 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-dione |
| SMILES | COc1ccc2nc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)C[C@H]3C)sc2c1 |
| InChI | InChI=1S/C22H21N3O4S/c1-14-13-24(21(27)15-6-4-3-5-7-15)10-11-25(14)22(28)19(26)20-23-17-9-8-16(29-2)12-18(17)30-20/h3-9,12,14H,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | JYSNFIHHPUIVPU-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|