C16H25N3O — CID 115971123
N-(2-ethoxyethyl)-2-(2-propylbenzimidazol-1-yl)ethanamine (PubChem CID 115971123) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-(2-propylbenzimidazol-1-yl)ethanamine.
| Compound Name | N-(2-ethoxyethyl)-2-(2-propylbenzimidazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 115971123 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-(2-ethoxyethyl)-2-(2-propylbenzimidazol-1-yl)ethanamine |
| SMILES | CCCc1nc2ccccc2n1CCNCCOCC |
| InChI | InChI=1S/C16H25N3O/c1-3-7-16-18-14-8-5-6-9-15(14)19(16)12-10-17-11-13-20-4-2/h5-6,8-9,17H,3-4,7,10-13H2,1-2H3 |
| InChIKey | JEAFMBHRRPNMDR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|