C20H22ClN3O2 — CID 16976156
2-chloro-N-[2-[1-(2-ethoxyethyl)benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16976156) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-(2-ethoxyethyl)benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-(2-ethoxyethyl)benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16976156 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-chloro-N-[2-[1-(2-ethoxyethyl)benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CCOCCn1c(CCNC(=O)c2ccccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C20H22ClN3O2/c1-2-26-14-13-24-18-10-6-5-9-17(18)23-19(24)11-12-22-20(25)15-7-3-4-8-16(15)21/h3-10H,2,11-14H2,1H3,(H,22,25) |
| InChIKey | RECUEBVYPPKGCV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|