C14H19ClN2O4 — CID 115971175
methyl 1-(4-chloro-1-propylpyrrole-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 115971175) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is methyl 1-(4-chloro-1-propylpyrrole-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-chloro-1-propylpyrrole-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115971175 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl 1-(4-chloro-1-propylpyrrole-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCn1cc(Cl)cc1C(=O)N1CC(O)CC1C(=O)OC |
| InChI | InChI=1S/C14H19ClN2O4/c1-3-4-16-7-9(15)5-11(16)13(19)17-8-10(18)6-12(17)14(20)21-2/h5,7,10,12,18H,3-4,6,8H2,1-2H3 |
| InChIKey | PAGMNVCHCQDQQK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |