C12H22N2OS — CID 115972512
4-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pentan-1-ol (PubChem CID 115972512) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 4-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pentan-1-ol.
| Compound Name | 4-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pentan-1-ol |
|---|---|
| PubChem CID | 115972512 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]pentan-1-ol |
| SMILES | CCc1cnc(C(C)NC(C)CCCO)s1 |
| InChI | InChI=1S/C12H22N2OS/c1-4-11-8-13-12(16-11)10(3)14-9(2)6-5-7-15/h8-10,14-15H,4-7H2,1-3H3 |
| InChIKey | MXNKVCRAOZGSIS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |