C20H20F2N2O3S2 — CID 11597324
2-butyl-4-[4-(difluoromethoxy)anilino]-1,1-dioxo-5-phenyl-1,2-thiazole-3-thione (PubChem CID 11597324) has the molecular formula C20H20F2N2O3S2 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-butyl-4-[4-(difluoromethoxy)anilino]-1,1-dioxo-5-phenyl-1,2-thiazole-3-thione.
| Compound Name | 2-butyl-4-[4-(difluoromethoxy)anilino]-1,1-dioxo-5-phenyl-1,2-thiazole-3-thione |
|---|---|
| PubChem CID | 11597324 |
| Molecular Formula | C20H20F2N2O3S2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-butyl-4-[4-(difluoromethoxy)anilino]-1,1-dioxo-5-phenyl-1,2-thiazole-3-thione |
| SMILES | CCCCN1C(=S)C(Nc2ccc(OC(F)F)cc2)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C20H20F2N2O3S2/c1-2-3-13-24-19(28)17(18(29(24,25)26)14-7-5-4-6-8-14)23-15-9-11-16(12-10-15)27-20(21)22/h4-12,20,23H,2-3,13H2,1H3 |
| InChIKey | HTKGIPVZCTWAPQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|