C20H22F2N2OS — CID 141146072
2-butyl-N-[4-(difluoromethoxy)phenyl]-5-phenyl-3H-1,2-thiazol-4-amine (PubChem CID 141146072) has the molecular formula C20H22F2N2OS and a molecular weight of 376.47 g/mol. Its IUPAC name is 2-butyl-N-[4-(difluoromethoxy)phenyl]-5-phenyl-3H-1,2-thiazol-4-amine.
| Compound Name | 2-butyl-N-[4-(difluoromethoxy)phenyl]-5-phenyl-3H-1,2-thiazol-4-amine |
|---|---|
| PubChem CID | 141146072 |
| Molecular Formula | C20H22F2N2OS |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-butyl-N-[4-(difluoromethoxy)phenyl]-5-phenyl-3H-1,2-thiazol-4-amine |
| SMILES | CCCCN1CC(Nc2ccc(OC(F)F)cc2)=C(c2ccccc2)S1 |
| InChI | InChI=1S/C20H22F2N2OS/c1-2-3-13-24-14-18(19(26-24)15-7-5-4-6-8-15)23-16-9-11-17(12-10-16)25-20(21)22/h4-12,20,23H,2-3,13-14H2,1H3 |
| InChIKey | YZHXJYSXUYYVQY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|