C24H20F4N2O2S — CID 154237285
N-[4-(difluoromethoxy)phenyl]-2-[[4-(difluoromethoxy)phenyl]methyl]-5-phenyl-3H-1,2-thiazol-4-amine (PubChem CID 154237285) has the molecular formula C24H20F4N2O2S and a molecular weight of 476.50 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[[4-(difluoromethoxy)phenyl]methyl]-5-phenyl-3H-1,2-thiazol-4-amine.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[[4-(difluoromethoxy)phenyl]methyl]-5-phenyl-3H-1,2-thiazol-4-amine |
|---|---|
| PubChem CID | 154237285 |
| Molecular Formula | C24H20F4N2O2S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[[4-(difluoromethoxy)phenyl]methyl]-5-phenyl-3H-1,2-thiazol-4-amine |
| SMILES | FC(F)Oc1ccc(CN2CC(Nc3ccc(OC(F)F)cc3)=C(c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C24H20F4N2O2S/c25-23(26)31-19-10-6-16(7-11-19)14-30-15-21(22(33-30)17-4-2-1-3-5-17)29-18-8-12-20(13-9-18)32-24(27)28/h1-13,23-24,29H,14-15H2 |
| InChIKey | POEXHZPOEWXYLF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|