C19H15F2N3O5 — CID 7819637
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 7819637) has the molecular formula C19H15F2N3O5 and a molecular weight of 403.34 g/mol. Its IUPAC name is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 7819637 |
| Molecular Formula | C19H15F2N3O5 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccccc2)C1=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H15F2N3O5/c20-18(21)29-14-8-6-13(7-9-14)22-15(25)11-24-17(27)16(26)23(19(24)28)10-12-4-2-1-3-5-12/h1-9,18H,10-11H2,(H,22,25) |
| InChIKey | IUNWZTGHBYOTBO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|