C22H17N3O4 — CID 7819935
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-naphthalen-2-ylacetamide (PubChem CID 7819935) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-naphthalen-2-ylacetamide.
| Compound Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 7819935 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-naphthalen-2-ylacetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccccc2)C1=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H17N3O4/c26-19(23-18-11-10-16-8-4-5-9-17(16)12-18)14-25-21(28)20(27)24(22(25)29)13-15-6-2-1-3-7-15/h1-12H,13-14H2,(H,23,26) |
| InChIKey | APPZHXYHSWGANN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|