C15H17Cl2N3O — CID 115974417
N-[2-(2,4-dichlorophenyl)ethyl]-4-propan-2-yloxypyrimidin-2-amine (PubChem CID 115974417) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-propan-2-yloxypyrimidin-2-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115974417 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-propan-2-yloxypyrimidin-2-amine |
| SMILES | CC(C)Oc1ccnc(NCCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H17Cl2N3O/c1-10(2)21-14-6-8-19-15(20-14)18-7-5-11-3-4-12(16)9-13(11)17/h3-4,6,8-10H,5,7H2,1-2H3,(H,18,19,20) |
| InChIKey | MBUTVKLKDPAUOU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |