C26H46O4Si — CID 11597594
(2S,4R,5S,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-5-hydroxy-6,8-dimethyl-9-phenylmethoxynonan-3-one (PubChem CID 11597594) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is (2S,4R,5S,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-5-hydroxy-6,8-dimethyl-9-phenylmethoxynonan-3-one.
| Compound Name | (2S,4R,5S,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-5-hydroxy-6,8-dimethyl-9-phenylmethoxynonan-3-one |
|---|---|
| PubChem CID | 11597594 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (2S,4R,5S,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-5-hydroxy-6,8-dimethyl-9-phenylmethoxynonan-3-one |
| SMILES | CC[C@@H](C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C)C[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C26H46O4Si/c1-10-23(25(28)21(4)30-31(8,9)26(5,6)7)24(27)20(3)16-19(2)17-29-18-22-14-12-11-13-15-22/h11-15,19-21,23-24,27H,10,16-18H2,1-9H3/t19-,20+,21+,23-,24+/m1/s1 |
| InChIKey | OEYWCSNMHBVIMT-OWDINHDYSA-N |
| XLogP | 6.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|