C12H20N2O — CID 115976030
4-[(4,6-dimethyl-2-pyridinyl)amino]pentan-1-ol (PubChem CID 115976030) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-[(4,6-dimethyl-2-pyridinyl)amino]pentan-1-ol.
| Compound Name | 4-[(4,6-dimethyl-2-pyridinyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 115976030 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-[(4,6-dimethyl-2-pyridinyl)amino]pentan-1-ol |
| SMILES | Cc1cc(C)nc(NC(C)CCCO)c1 |
| InChI | InChI=1S/C12H20N2O/c1-9-7-11(3)14-12(8-9)13-10(2)5-4-6-15/h7-8,10,15H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | VOYGTQRZGWBMGR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |