C13H24N4O — CID 80852528
4-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]pentan-1-ol (PubChem CID 80852528) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]pentan-1-ol.
| Compound Name | 4-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 80852528 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 4-[[2-methyl-6-(propylamino)pyrimidin-4-yl]amino]pentan-1-ol |
| SMILES | CCCNc1cc(NC(C)CCCO)nc(C)n1 |
| InChI | InChI=1S/C13H24N4O/c1-4-7-14-12-9-13(17-11(3)16-12)15-10(2)6-5-8-18/h9-10,18H,4-8H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | KBDIZGVIZSPYPP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |