C10H21NO4 — CID 115976307
methyl 2-hydroxy-3-[3-hydroxybutyl(methyl)amino]-2-methylpropanoate (PubChem CID 115976307) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[3-hydroxybutyl(methyl)amino]-2-methylpropanoate.
| Compound Name | methyl 2-hydroxy-3-[3-hydroxybutyl(methyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 115976307 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | methyl 2-hydroxy-3-[3-hydroxybutyl(methyl)amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CN(C)CCC(C)O |
| InChI | InChI=1S/C10H21NO4/c1-8(12)5-6-11(3)7-10(2,14)9(13)15-4/h8,12,14H,5-7H2,1-4H3 |
| InChIKey | DAQHMJFLEOIFEE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |