C12H25N3O3 — CID 113246222
N-(tert-butylcarbamoyl)-2-[3-hydroxybutyl(methyl)amino]acetamide (PubChem CID 113246222) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-[3-hydroxybutyl(methyl)amino]acetamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-[3-hydroxybutyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 113246222 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-[3-hydroxybutyl(methyl)amino]acetamide |
| SMILES | CC(O)CCN(C)CC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H25N3O3/c1-9(16)6-7-15(5)8-10(17)13-11(18)14-12(2,3)4/h9,16H,6-8H2,1-5H3,(H2,13,14,17,18) |
| InChIKey | QQNWNLRZBKTIFC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |