C17H27N3O2 — CID 4818784
N-(tert-butylcarbamoyl)-2-[(4-ethylphenyl)methyl-methylamino]acetamide (PubChem CID 4818784) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-[(4-ethylphenyl)methyl-methylamino]acetamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-[(4-ethylphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 4818784 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-[(4-ethylphenyl)methyl-methylamino]acetamide |
| SMILES | CCc1ccc(CN(C)CC(=O)NC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-6-13-7-9-14(10-8-13)11-20(5)12-15(21)18-16(22)19-17(2,3)4/h7-10H,6,11-12H2,1-5H3,(H2,18,19,21,22) |
| InChIKey | UXNILWKXVSFGDO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |