C13H20BrN3O3 — CID 37420375
2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(tert-butylcarbamoyl)acetamide (PubChem CID 37420375) has the molecular formula C13H20BrN3O3 and a molecular weight of 346.23 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(tert-butylcarbamoyl)acetamide.
| Compound Name | 2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(tert-butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 37420375 |
| Molecular Formula | C13H20BrN3O3 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(tert-butylcarbamoyl)acetamide |
| SMILES | CN(CC(=O)NC(=O)NC(C)(C)C)Cc1ccc(Br)o1 |
| InChI | InChI=1S/C13H20BrN3O3/c1-13(2,3)16-12(19)15-11(18)8-17(4)7-9-5-6-10(14)20-9/h5-6H,7-8H2,1-4H3,(H2,15,16,18,19) |
| InChIKey | LYAJIQMRKRRETF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |