C14H16BrN3O3S — CID 37422554
2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 37422554) has the molecular formula C14H16BrN3O3S and a molecular weight of 386.27 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 37422554 |
| Molecular Formula | C14H16BrN3O3S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-[(5-bromofuran-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | CN(CC(=O)NC(=O)NCc1cccs1)Cc1ccc(Br)o1 |
| InChI | InChI=1S/C14H16BrN3O3S/c1-18(8-10-4-5-12(15)21-10)9-13(19)17-14(20)16-7-11-3-2-6-22-11/h2-6H,7-9H2,1H3,(H2,16,17,19,20) |
| InChIKey | WKBYGXVKQJFDAN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |