C14H16BrN3OS — CID 166216279
2-[(6-bromo-3-pyridinyl)methyl-methylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 166216279) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is 2-[(6-bromo-3-pyridinyl)methyl-methylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(6-bromo-3-pyridinyl)methyl-methylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 166216279 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 2-[(6-bromo-3-pyridinyl)methyl-methylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN(CC(=O)NCc1cccs1)Cc1ccc(Br)nc1 |
| InChI | InChI=1S/C14H16BrN3OS/c1-18(9-11-4-5-13(15)16-7-11)10-14(19)17-8-12-3-2-6-20-12/h2-7H,8-10H2,1H3,(H,17,19) |
| InChIKey | RAIWINBWNZJYJY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|