C17H20FN3O3S — CID 26387450
2-[2-(2-fluorophenoxy)ethyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 26387450) has the molecular formula C17H20FN3O3S and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[2-(2-fluorophenoxy)ethyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[2-(2-fluorophenoxy)ethyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 26387450 |
| Molecular Formula | C17H20FN3O3S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[2-(2-fluorophenoxy)ethyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | CN(CCOc1ccccc1F)CC(=O)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H20FN3O3S/c1-21(8-9-24-15-7-3-2-6-14(15)18)12-16(22)20-17(23)19-11-13-5-4-10-25-13/h2-7,10H,8-9,11-12H2,1H3,(H2,19,20,22,23) |
| InChIKey | KTBPJLQDMXLDCF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |