C14H16ClN3O2S2 — CID 40741355
2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 40741355) has the molecular formula C14H16ClN3O2S2 and a molecular weight of 357.89 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 40741355 |
| Molecular Formula | C14H16ClN3O2S2 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | CN(CC(=O)NC(=O)NCc1cccs1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H16ClN3O2S2/c1-18(8-11-4-5-12(15)22-11)9-13(19)17-14(20)16-7-10-3-2-6-21-10/h2-6H,7-9H2,1H3,(H2,16,17,19,20) |
| InChIKey | PRDYSOJNCNVJTM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |