C9H18N2OS — CID 115976802
N-(2-methylsulfanylpropyl)pyrrolidine-2-carboxamide (PubChem CID 115976802) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is N-(2-methylsulfanylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-methylsulfanylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 115976802 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-(2-methylsulfanylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CSC(C)CNC(=O)C1CCCN1 |
| InChI | InChI=1S/C9H18N2OS/c1-7(13-2)6-11-9(12)8-4-3-5-10-8/h7-8,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | OWLBAJTURGFQHF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |