C10H21N3O2 — CID 148575646
(2S)-N-[(2R)-2-(1-hydroxyethylamino)propyl]pyrrolidine-2-carboxamide (PubChem CID 148575646) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-(1-hydroxyethylamino)propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-2-(1-hydroxyethylamino)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 148575646 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (2S)-N-[(2R)-2-(1-hydroxyethylamino)propyl]pyrrolidine-2-carboxamide |
| SMILES | CC(O)N[C@H](C)CNC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H21N3O2/c1-7(13-8(2)14)6-12-10(15)9-4-3-5-11-9/h7-9,11,13-14H,3-6H2,1-2H3,(H,12,15)/t7-,8?,9+/m1/s1 |
| InChIKey | MXSVPOMIVIFYPM-NBXIYJJMSA-N |
| XLogP | -0.83 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|