C12H23NO2 — CID 115977876
2,2-dimethyl-3-[(2-methyloxan-4-yl)amino]cyclobutan-1-ol (PubChem CID 115977876) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2-methyloxan-4-yl)amino]cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-[(2-methyloxan-4-yl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 115977876 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,2-dimethyl-3-[(2-methyloxan-4-yl)amino]cyclobutan-1-ol |
| SMILES | CC1CC(NC2CC(O)C2(C)C)CCO1 |
| InChI | InChI=1S/C12H23NO2/c1-8-6-9(4-5-15-8)13-10-7-11(14)12(10,2)3/h8-11,13-14H,4-7H2,1-3H3 |
| InChIKey | RCAZIPRRTAPJLW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |