C11H20FNO — CID 130702555
N-[(1S,2R)-2-fluorocyclopentyl]-2-methyloxan-4-amine (PubChem CID 130702555) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is N-[(1S,2R)-2-fluorocyclopentyl]-2-methyloxan-4-amine.
| Compound Name | N-[(1S,2R)-2-fluorocyclopentyl]-2-methyloxan-4-amine |
|---|---|
| PubChem CID | 130702555 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-[(1S,2R)-2-fluorocyclopentyl]-2-methyloxan-4-amine |
| SMILES | CC1CC(N[C@H]2CCC[C@H]2F)CCO1 |
| InChI | InChI=1S/C11H20FNO/c1-8-7-9(5-6-14-8)13-11-4-2-3-10(11)12/h8-11,13H,2-7H2,1H3/t8?,9?,10-,11+/m1/s1 |
| InChIKey | WFPRTYHIOYCTKM-LXKPXOPUSA-N |
| XLogP | 2.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |