C10H18FN — CID 126847798
trans-(1R,2R)-N-cyclobutyl-2-fluorocyclohexan-1-amine (PubChem CID 126847798) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is trans-(1R,2R)-N-cyclobutyl-2-fluorocyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-N-cyclobutyl-2-fluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 126847798 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | trans-(1R,2R)-N-cyclobutyl-2-fluorocyclohexan-1-amine |
| SMILES | F[C@@H]1CCCC[C@H]1NC1CCC1 |
| InChI | InChI=1S/C10H18FN/c11-9-6-1-2-7-10(9)12-8-4-3-5-8/h8-10,12H,1-7H2/t9-,10-/m1/s1 |
| InChIKey | LAUCERBZZBNPOH-NXEZZACHSA-N |
| XLogP | 2.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |