C11H20FN — CID 126847823
N-[(1R,2R)-2-fluorocyclopentyl]cyclohexanamine (PubChem CID 126847823) has the molecular formula C11H20FN and a molecular weight of 185.29 g/mol. Its IUPAC name is N-[(1R,2R)-2-fluorocyclopentyl]cyclohexanamine.
| Compound Name | N-[(1R,2R)-2-fluorocyclopentyl]cyclohexanamine |
|---|---|
| PubChem CID | 126847823 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | N-[(1R,2R)-2-fluorocyclopentyl]cyclohexanamine |
| SMILES | F[C@@H]1CCC[C@H]1NC1CCCCC1 |
| InChI | InChI=1S/C11H20FN/c12-10-7-4-8-11(10)13-9-5-2-1-3-6-9/h9-11,13H,1-8H2/t10-,11-/m1/s1 |
| InChIKey | UTLAZWLBLYOQEU-GHMZBOCLSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |