C13H21NO2 — CID 115978599
4-[[(2-hydroxy-2,3-dimethylbutyl)amino]methyl]phenol (PubChem CID 115978599) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-[[(2-hydroxy-2,3-dimethylbutyl)amino]methyl]phenol.
| Compound Name | 4-[[(2-hydroxy-2,3-dimethylbutyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115978599 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 4-[[(2-hydroxy-2,3-dimethylbutyl)amino]methyl]phenol |
| SMILES | CC(C)C(C)(O)CNCc1ccc(O)cc1 |
| InChI | InChI=1S/C13H21NO2/c1-10(2)13(3,16)9-14-8-11-4-6-12(15)7-5-11/h4-7,10,14-16H,8-9H2,1-3H3 |
| InChIKey | PLQNHHPYINZZAR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |