C15H24ClN3OS — CID 115985375
N-(3-amino-4-chlorophenyl)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanamide (PubChem CID 115985375) has the molecular formula C15H24ClN3OS and a molecular weight of 329.90 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 115985375 |
| Molecular Formula | C15H24ClN3OS |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3-[methyl(1-methylsulfanylbutan-2-yl)amino]propanamide |
| SMILES | CCC(CSC)N(C)CCC(=O)Nc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C15H24ClN3OS/c1-4-12(10-21-3)19(2)8-7-15(20)18-11-5-6-13(16)14(17)9-11/h5-6,9,12H,4,7-8,10,17H2,1-3H3,(H,18,20) |
| InChIKey | WVPLMYQAELJLFZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|