C14H22ClNO3S2 — CID 115988224
4-(3-chloropropoxy)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 115988224) has the molecular formula C14H22ClNO3S2 and a molecular weight of 351.92 g/mol. Its IUPAC name is 4-(3-chloropropoxy)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-(3-chloropropoxy)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115988224 |
| Molecular Formula | C14H22ClNO3S2 |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-(3-chloropropoxy)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1ccc(OCCCCl)cc1 |
| InChI | InChI=1S/C14H22ClNO3S2/c1-12(11-20-3)16(2)21(17,18)14-7-5-13(6-8-14)19-10-4-9-15/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | JMTYHRWGXBEXIY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|