C13H21NO3S2 — CID 59983813
N-methyl-4-propoxy-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide (PubChem CID 59983813) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-methyl-4-propoxy-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide.
| Compound Name | N-methyl-4-propoxy-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 59983813 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-methyl-4-propoxy-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)N(C)[C@H](C)CS)cc1 |
| InChI | InChI=1S/C13H21NO3S2/c1-4-9-17-12-5-7-13(8-6-12)19(15,16)14(3)11(2)10-18/h5-8,11,18H,4,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | DZUXROMZASUJCO-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|