C20H34N2O3S2 — CID 22711748
4-butoxy-N-(2-piperidin-1-ylethyl)-N-(1-sulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 22711748) has the molecular formula C20H34N2O3S2 and a molecular weight of 414.64 g/mol. Its IUPAC name is 4-butoxy-N-(2-piperidin-1-ylethyl)-N-(1-sulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-butoxy-N-(2-piperidin-1-ylethyl)-N-(1-sulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22711748 |
| Molecular Formula | C20H34N2O3S2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 4-butoxy-N-(2-piperidin-1-ylethyl)-N-(1-sulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N(CCN2CCCCC2)C(C)CS)cc1 |
| InChI | InChI=1S/C20H34N2O3S2/c1-3-4-16-25-19-8-10-20(11-9-19)27(23,24)22(18(2)17-26)15-14-21-12-6-5-7-13-21/h8-11,18,26H,3-7,12-17H2,1-2H3 |
| InChIKey | XUZYJPOWBHJCGX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|