C22H30N2O2S3 — CID 20732032
N-(2-piperidin-1-ylethyl)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide (PubChem CID 20732032) has the molecular formula C22H30N2O2S3 and a molecular weight of 450.70 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide.
| Compound Name | N-(2-piperidin-1-ylethyl)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 20732032 |
| Molecular Formula | C22H30N2O2S3 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide |
| SMILES | C[C@H](CS)N(CCN1CCCCC1)S(=O)(=O)c1ccc(C2=CC=CCC2=S)cc1 |
| InChI | InChI=1S/C22H30N2O2S3/c1-18(17-27)24(16-15-23-13-5-2-6-14-23)29(25,26)20-11-9-19(10-12-20)21-7-3-4-8-22(21)28/h3-4,7,9-12,18,27H,2,5-6,8,13-17H2,1H3/t18-/m1/s1 |
| InChIKey | MKOPAFUYLRALIV-GOSISDBHSA-N |
| XLogP | 4.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|