C20H31F3N2O2S — CID 141043385
N-[2-(azepan-1-yl)ethyl]-N-ethyl-1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-amine (PubChem CID 141043385) has the molecular formula C20H31F3N2O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-N-ethyl-1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-amine.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-N-ethyl-1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 141043385 |
| Molecular Formula | C20H31F3N2O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-N-ethyl-1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-amine |
| SMILES | CCN(CCN1CCCCCC1)C(C)Cc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H31F3N2O2S/c1-3-25(15-14-24-12-6-4-5-7-13-24)17(2)16-18-8-10-19(11-9-18)28(26,27)20(21,22)23/h8-11,17H,3-7,12-16H2,1-2H3 |
| InChIKey | ZUXDMYCBPSLFPD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |