C13H14F3NO6S — CID 174359325
formyl (2S)-2-[ethyl(hydroxy)amino]-3-[4-(trifluoromethylsulfonyl)phenyl]propanoate (PubChem CID 174359325) has the molecular formula C13H14F3NO6S and a molecular weight of 369.32 g/mol. Its IUPAC name is formyl (2S)-2-[ethyl(hydroxy)amino]-3-[4-(trifluoromethylsulfonyl)phenyl]propanoate.
| Compound Name | formyl (2S)-2-[ethyl(hydroxy)amino]-3-[4-(trifluoromethylsulfonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 174359325 |
| Molecular Formula | C13H14F3NO6S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | formyl (2S)-2-[ethyl(hydroxy)amino]-3-[4-(trifluoromethylsulfonyl)phenyl]propanoate |
| SMILES | CCN(O)[C@@H](Cc1ccc(S(=O)(=O)C(F)(F)F)cc1)C(=O)OC=O |
| InChI | InChI=1S/C13H14F3NO6S/c1-2-17(20)11(12(19)23-8-18)7-9-3-5-10(6-4-9)24(21,22)13(14,15)16/h3-6,8,11,20H,2,7H2,1H3/t11-/m0/s1 |
| InChIKey | PSWUTQQYEBKZRQ-NSHDSACASA-N |
| XLogP | 1.30 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|