C22H28N2O7 — CID 155773814
[(2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoyl] (2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 155773814) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is [(2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoyl] (2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | [(2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoyl] (2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 155773814 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [(2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoyl] (2S)-2-[ethyl(hydroxy)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCN(O)[C@@H](Cc1ccc(O)cc1)C(=O)OC(=O)[C@H](Cc1ccc(O)cc1)N(O)CC |
| InChI | InChI=1S/C22H28N2O7/c1-3-23(29)19(13-15-5-9-17(25)10-6-15)21(27)31-22(28)20(24(30)4-2)14-16-7-11-18(26)12-8-16/h5-12,19-20,25-26,29-30H,3-4,13-14H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | POEXNWDVISARTP-PMACEKPBSA-N |
| XLogP | 2.11 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|