C14H19N3O4 — CID 174300055
N'-[(2R)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-N'-methylbutanediamide (PubChem CID 174300055) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is N'-[(2R)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-N'-methylbutanediamide.
| Compound Name | N'-[(2R)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 174300055 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N'-[(2R)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-N'-methylbutanediamide |
| SMILES | CN(C(=O)CCC(N)=O)[C@H](Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C14H19N3O4/c1-17(13(20)7-6-12(15)19)11(14(16)21)8-9-2-4-10(18)5-3-9/h2-5,11,18H,6-8H2,1H3,(H2,15,19)(H2,16,21)/t11-/m1/s1 |
| InChIKey | SHLGIFIOISPCPO-LLVKDONJSA-N |
| XLogP | -0.49 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |