C22H33F3N2O3S — CID 174378805
1-[4-[ethyl-[1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-yl]amino]butyl]piperidine-2-carbaldehyde (PubChem CID 174378805) has the molecular formula C22H33F3N2O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 1-[4-[ethyl-[1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-yl]amino]butyl]piperidine-2-carbaldehyde.
| Compound Name | 1-[4-[ethyl-[1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-yl]amino]butyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174378805 |
| Molecular Formula | C22H33F3N2O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-[4-[ethyl-[1-[4-(trifluoromethylsulfonyl)phenyl]propan-2-yl]amino]butyl]piperidine-2-carbaldehyde |
| SMILES | CCN(CCCCN1CCCCC1C=O)C(C)Cc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H33F3N2O3S/c1-3-26(13-6-7-15-27-14-5-4-8-20(27)17-28)18(2)16-19-9-11-21(12-10-19)31(29,30)22(23,24)25/h9-12,17-18,20H,3-8,13-16H2,1-2H3 |
| InChIKey | FHNKVAKHXLPADS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|