C25H44N4O5S2 — CID 174404521
4-[2-(dimethylamino)ethylsulfonyl]-1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]piperazine-2-carbaldehyde (PubChem CID 174404521) has the molecular formula C25H44N4O5S2 and a molecular weight of 544.78 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylsulfonyl]-1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]piperazine-2-carbaldehyde.
| Compound Name | 4-[2-(dimethylamino)ethylsulfonyl]-1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174404521 |
| Molecular Formula | C25H44N4O5S2 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | 4-[2-(dimethylamino)ethylsulfonyl]-1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]piperazine-2-carbaldehyde |
| SMILES | CCN(CCCCN1CCN(S(=O)(=O)CCN(C)C)CC1C=O)C(C)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H44N4O5S2/c1-6-27(22(2)19-23-9-11-25(12-10-23)35(5,31)32)13-7-8-14-28-15-16-29(20-24(28)21-30)36(33,34)18-17-26(3)4/h9-12,21-22,24H,6-8,13-20H2,1-5H3 |
| InChIKey | ZYZSRGRHWIXEHY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|