C22H35N3O3 — CID 69225052
methyl 4-[2-[ethyl-[4-(7-oxo-1,4-diazepan-1-yl)butyl]amino]propyl]benzoate (PubChem CID 69225052) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is methyl 4-[2-[ethyl-[4-(7-oxo-1,4-diazepan-1-yl)butyl]amino]propyl]benzoate.
| Compound Name | methyl 4-[2-[ethyl-[4-(7-oxo-1,4-diazepan-1-yl)butyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 69225052 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | methyl 4-[2-[ethyl-[4-(7-oxo-1,4-diazepan-1-yl)butyl]amino]propyl]benzoate |
| SMILES | CCN(CCCCN1CCNCCC1=O)C(C)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C22H35N3O3/c1-4-24(14-5-6-15-25-16-13-23-12-11-21(25)26)18(2)17-19-7-9-20(10-8-19)22(27)28-3/h7-10,18,23H,4-6,11-17H2,1-3H3 |
| InChIKey | YRFJBAIZTHAMHT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|